| Product Name | Triethyl 1,1,2-ethanetricarboxylate |
| CAS No. | 7459-46-3 |
| Synonyms | 1,1,2-Ethanetricarboxylic acid triethyl ester; Triethyl ethane-1,1,2-tricarboxylate; 1,1,2-Ethanetricarboxylic acid, 1,1,2-triethyl ester; |
| InChI | InChI=1/C11H18O6/c1-4-15-9(12)7-8(10(13)16-5-2)11(14)17-6-3/h8H,4-7H2,1-3H3 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.257 |
| Density | 1.114g/cm3 |
| Boiling point | 300.7°C at 760 mmHg |
| Flash point | 127.4°C |
| Refractive index | 1.44 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
7459-46-3 triethyl 1,1,2-ethanetricarboxylate
service@apichina.com