| Product Name | tridecyl dihydrogen phosphate, compound with N,N-dimethyl-1-octadecylamine (1:1) |
| CAS No. | 67846-17-7 |
| Synonyms | 1-Tridecanol, dihydrogen phosphate, compd. with N,N-dimethyl-1-octadecanamine (1:1); Tridecyl dihydrogen phosphate, compound with N,N-dimethyl-1-octadecylamine (1:1); tridecyl dihydrogen phosphate - N,N-dimethyloctadecan-1-amine (1:1) |
| InChI | InChI=1/C20H43N.C13H29O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-17-18(14,15)16/h4-20H2,1-3H3;2-13H2,1H3,(H2,14,15,16) |
| Molecular Formula | C33H72NO4P |
| Molecular Weight | 577.9028 |
| Boiling point | 348.5°C at 760 mmHg |
| Flash point | 153.8°C |
67846-17-7 tridecyl dihydrogen phosphate, compound with n,n-dimethyl-1-octadecylamine (1:1)
service@apichina.com