| Product Name | Trichloro(indenyl)titanium(IV) |
| CAS No. | 84365-55-9 |
| Synonyms | Indenyltitaniumtrichloride; trichloro(1H-inden-1-yl)titanium |
| InChI | InChI=1/C9H7.3ClH.Ti/c1-2-5-9-7-3-6-8(9)4-1;;;;/h1-7H;3*1H;/q;;;;+3/p-3/rC9H7Cl3Ti/c10-13(11,12)9-6-5-7-3-1-2-4-8(7)9/h1-6,9H |
| Molecular Formula | C9H7Cl3Ti |
| Molecular Weight | 269.3779 |
| Melting point | 162℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
84365-55-9 trichloro(indenyl)titanium(iv)
service@apichina.com