| Product Name | Tributylborane |
| CAS No. | 122-56-5 |
| Synonyms | Tri-n-butylborane; Boronbutoxide; ributylborane |
| InChI | InChI=1/C12H27B/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
| Molecular Formula | C12H27B |
| Molecular Weight | 182.1538 |
| Density | 0.732g/cm3 |
| Boiling point | 209°C at 760 mmHg |
| Flash point | 94.9°C |
| Refractive index | 1.406 |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R17:Spontaneously flammable in air.; R19:May form explosive peroxides.; R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S33:Take precautionary measures against static discharges.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
122-56-5 tributylborane
service@apichina.com