| Product Name | Tri-sec-butylborane |
| CAS No. | 1113-78-6 |
| Synonyms | tributan-2-ylborane; Tri(1-methylpropyl)borane; Tri-sec-butylboron; Tris(sec-butyl)borane |
| InChI | InChI=1/C12H27B/c1-7-10(4)13(11(5)8-2)12(6)9-3/h10-12H,7-9H2,1-6H3 |
| Molecular Formula | C12H27B |
| Molecular Weight | 182.1538 |
| Density | 0.729g/cm3 |
| Boiling point | 212.1°C at 760 mmHg |
| Flash point | 86.8°C |
| Refractive index | 1.403 |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R17:Spontaneously flammable in air.; R19:May form explosive peroxides.; R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S33:Take precautionary measures against static discharges.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1113-78-6 tri-sec-butylborane
service@apichina.com