| Product Name | Tri-n-propylsilane |
| CAS No. | 998-29-8 |
| Synonyms | Silane, tripropyl-; NSC 96837; Tripropylsilane; tripropylsilyl |
| InChI | InChI=1/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
| Molecular Formula | C9H21Si |
| Molecular Weight | 157.3485 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
998-29-8 tri-n-propylsilane
service@apichina.com