| Product Name | tri(2-hydroxyethyl)ammonium (2,4,5-trichlorophenoxy)acetate |
| CAS No. | 3813-14-7 |
| Synonyms | 2,4,5-T-trolamine [ISO]; 2,4,5-T triethanolamine salt; 2,4,5-T-Tris(2-hydroxyethyl)ammonium; 2,4,5-T-trolamine; 2,4,5-Trichlorophenoxyacetic acid triethanolamine salt; Caswell No. 881J; EPA Pesticide Chemical Code 082033; Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); Tri(2-hydroxyethyl)ammonium (2,4,5-trichlorophenoxy)acetate; Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with 2,2',2''-nitrilotris(ethanol); (2,4,5-trichlorophenoxy)acetic acid - 2,2',2''-nitrilotriethanol (1:1) |
| InChI | InChI=1/C8H5Cl3O3.C6H15NO3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;8-4-1-7(2-5-9)3-6-10/h1-2H,3H2,(H,12,13);8-10H,1-6H2 |
| Molecular Formula | C14H20Cl3NO6 |
| Molecular Weight | 404.6707 |
| Boiling point | 376.3°C at 760 mmHg |
| Flash point | 181.4°C |
3813-14-7 tri(2-hydroxyethyl)ammonium (2,4,5-trichlorophenoxy)acetate
service@apichina.com
- Next:3813-26-1 propanamide,3-(butylamino)-
- Previous:3813-05-6 benazolin