| Product Name | trans,trans-Bis(4-fluorobenzylidene)acetone |
| CAS No. | 53369-00-9 |
| Synonyms | 1,5-Bis(4-fluorophenyl)-1,4-pentadien-3-one; (1E,4E)-1,5-bis(4-fluorophenyl)penta-1,4-dien-3-one |
| InChI | InChI=1/C17H12F2O/c18-15-7-1-13(2-8-15)5-11-17(20)12-6-14-3-9-16(19)10-4-14/h1-12H/b11-5+,12-6+ |
| Molecular Formula | C17H12F2O |
| Molecular Weight | 270.2734 |
| Density | 1.221g/cm3 |
| Melting point | 142℃ |
| Boiling point | 398.6°C at 760 mmHg |
| Flash point | 151.8°C |
| Refractive index | 1.618 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
53369-00-9 trans,trans-bis(4-fluorobenzylidene)acetone
service@apichina.com