| Product Name | trans,trans-2,4-Hexadienal diethyl acetal |
| CAS No. | 27310-22-1 |
| Synonyms | 1,1-Diethoxy-2,4-hexadiene~Sorbic aldehyde diethyl acetal; (2E,4E)-1,1-diethoxyhexa-2,4-diene; 1,1-diethoxyhexa-2,4-diene |
| InChI | InChI=1/C10H18O2/c1-4-7-8-9-10(11-5-2)12-6-3/h4,7-10H,5-6H2,1-3H3 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.2487 |
| Density | 0.877g/cm3 |
| Boiling point | 217.7°C at 760 mmHg |
| Flash point | 77.8°C |
| Refractive index | 1.448 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
27310-22-1 trans,trans-2,4-hexadienal diethyl acetal
service@apichina.com