| Product Name | trans-4-methyl-beta-nitrostyrene |
| CAS No. | 5153-68-4 |
| Synonyms | 1-(4-Methylphenyl)-2-nitroethylene~1-(p-Tolyl)-2-nitroethylene; 1-methyl-4-[(E)-2-nitroethenyl]benzene |
| InChI | InChI=1/C9H9NO2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-7H,1H3/b7-6+ |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.1733 |
| Density | 1.141g/cm3 |
| Melting point | 102-104℃ |
| Boiling point | 275.017°C at 760 mmHg |
| Flash point | 124.924°C |
| Refractive index | 1.592 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5153-68-4 trans-4-methyl-beta-nitrostyrene
service@apichina.com