| Product Name | trans-4-(beta-Nitrovinyl)benzeneboronic acid |
| CAS No. | 216394-04-6 |
| Synonyms | 4-Borono-trans-beta-nitrostyrene; trans-4-(beta-Nitrovinyl)phenylboronic acid; 4-[(E)-2-nitrovinyl]phenylboronic acid; {4-[(E)-2-nitroethenyl]phenyl}boronic acid; (E)-(4-(2-Nitrovinyl)phenyl)boronicacid |
| InChI | InChI=1/C8H8BNO4/c11-9(12)8-3-1-7(2-4-8)5-6-10(13)14/h1-6,11-12H/b6-5+ |
| Molecular Formula | C8H8BNO4 |
| Molecular Weight | 192.9644 |
| Density | 1.32g/cm3 |
| Boiling point | 412.6°C at 760 mmHg |
| Flash point | 203.3°C |
| Refractive index | 1.581 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
216394-04-6 trans-4-(beta-nitrovinyl)benzeneboronic acid
service@apichina.com