| Product Name | trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride |
| CAS No. | 4582-21-2 |
| Synonyms | trans-5-Norbornene-2,3-dicarbonyl chloride; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl Chloride; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
| InChI | InChI=1/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4-,5+,6-,7-/m0/s1 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.0646 |
| Density | 1.453g/cm3 |
| Boiling point | 243.334°C at 760 mmHg |
| Flash point | 133.454°C |
| Refractive index | 1.56 |
| Hazard Symbols | |
| Risk Codes | R34:Causes burns.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
4582-21-2 trans-3,6-endo-methylene-1,2,3,6-tetrahydrophthaloyl chloride
service@apichina.com