| Product Name | trans-3-(4-methylbenzoyl)acrylic acid |
| CAS No. | 20972-36-5 |
| Synonyms | 3-(4-Methylbenzoyl)acrylic acid; (2E)-4-(4-methylphenyl)-4-oxobut-2-enoic acid |
| InChI | InChI=1/C11H10O3/c1-8-2-4-9(5-3-8)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+ |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.1953 |
| Density | 1.2g/cm3 |
| Melting point | 138-140℃ |
| Boiling point | 361.8°C at 760 mmHg |
| Flash point | 186.8°C |
| Refractive index | 1.569 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20972-36-5 trans-3-(4-methylbenzoyl)acrylic acid
service@apichina.com