| Product Name | trans-3-(3-pyridyl)acrylic acid |
| CAS No. | 19337-97-4 |
| Synonyms | 3-(3-Pyridine)acrylic acid; (E)-3-(3-pyridinyl)acrylic acid |
| InChI | InChI=1/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11)/b4-3+ |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.14 |
| Melting point | 232-235℃ |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
19337-97-4 trans-3-(3-pyridyl)acrylic acid
service@apichina.com