| Product Name | trans-2-Heptenoic acid |
| CAS No. | 10352-88-2 |
| Synonyms | Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
| InChI | InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.169 |
| Density | 0.968g/cm3 |
| Boiling point | 226.6°C at 760 mmHg |
| Flash point | 133.4°C |
| Refractive index | 1.457 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
10352-88-2 trans-2-heptenoic acid
service@apichina.com