| Product Name | trans-2-ethoxy-5-(1-propenyl)phenol |
| CAS No. | 94-86-0 |
| Synonyms | 2-Ethoxy-5-prop-1-enylphenol; 5-propenylguaethol; Vanitrope; 2-ethoxy-5-(prop-1-en-1-yl)phenol; 2-ethoxy-5-[(1E)-prop-1-en-1-yl]phenol; Propenyl guaethol |
| InChI | InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.2277 |
| Density | 1.052g/cm3 |
| Melting point | 86-88℃ |
| Boiling point | 312.8°C at 760 mmHg |
| Flash point | 165.2°C |
| Refractive index | 1.567 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
94-86-0 trans-2-ethoxy-5-(1-propenyl)phenol
service@apichina.com