| Product Name | trans-2,3-dihydroxy-1,4-dioxane |
| CAS No. | 4845-50-5 |
| Synonyms | 2,3-Dihydroxy-1,4-dioxane; Glyoxal monoethylene acetal; Dioxanediol; 1,4-dioxane-2,3-diol; trans-1,4-Dioxane-2,3-diol |
| InChI | InChI=1/C4H8O4/c5-3-4(6)8-2-1-7-3/h3-6H,1-2H2 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 120.1039 |
| Density | 1.455g/cm3 |
| Melting point | 91-95℃ |
| Boiling point | 259.4°C at 760 mmHg |
| Flash point | 110.7°C |
| Refractive index | 1.513 |
| Risk Codes | R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
service@apichina.com