| Product Name | trans-1,2-Bis(4-fluorobenzoyl)ethylene |
| CAS No. | 25650-13-9 |
| Synonyms | (2E)-1,4-bis(4-fluorophenyl)but-2-ene-1,4-dione |
| InChI | InChI=1/C16H10F2O2/c17-13-5-1-11(2-6-13)15(19)9-10-16(20)12-3-7-14(18)8-4-12/h1-10H/b10-9+ |
| Molecular Formula | C16H10F2O2 |
| Molecular Weight | 272.2462 |
| Density | 1.263g/cm3 |
| Boiling point | 389.7°C at 760 mmHg |
| Flash point | 148.6°C |
| Refractive index | 1.568 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
25650-13-9 trans-1,2-bis(4-fluorobenzoyl)ethylene
service@apichina.com