| Product Name | Thiophene-2-thiocarboxamide |
| CAS No. | 20300-02-1 |
| Synonyms | Thiophene-2-carbothioamide |
| InChI | InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
| Molecular Formula | C5H5NS2 |
| Molecular Weight | 143.2299 |
| Density | 1.357g/cm3 |
| Melting point | 106℃ |
| Boiling point | 259.5°C at 760 mmHg |
| Flash point | 110.7°C |
| Refractive index | 1.701 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
20300-02-1 thiophene-2-thiocarboxamide
service@apichina.com