| Product Name | Thiophene-2-carboxylic acid methy lester |
| CAS No. | 5380-42-7 |
| Synonyms | Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
| InChI | InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| Molecular Formula | C6H6O2S |
| Molecular Weight | 142.1756 |
| Density | 1.217g/cm3 |
| Boiling point | 200.2°C at 760 mmHg |
| Flash point | 74.9°C |
| Refractive index | 1.535 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
5380-42-7 thiophene-2-carboxylic acid methy lester
service@apichina.com