| Product Name | Thiophene-2-carboxylic acid anhydride |
| CAS No. | 25569-97-5 |
| Synonyms | Thiophene-2-carboxylic anhydride; 2-Thienic anhydride |
| InChI | InChI=1/C10H6O3S2/c11-9(7-3-1-5-14-7)13-10(12)8-4-2-6-15-8/h1-6H |
| Molecular Formula | C10H6O3S2 |
| Molecular Weight | 238.2828 |
| Density | 1.438g/cm3 |
| Boiling point | 381.3°C at 760 mmHg |
| Flash point | 184.4°C |
| Refractive index | 1.64 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
25569-97-5 thiophene-2-carboxylic acid anhydride
service@apichina.com