| Product Name | thiophene-2-carboximidamide hydrochloride |
| CAS No. | 54610-70-7 |
| Synonyms | 2-Amidinothiophene Hydrochloride |
| InChI | InChI=1/C5H6N2S.ClH/c6-5(7)4-2-1-3-8-4;/h1-3H,(H3,6,7);1H |
| Molecular Formula | C5H7ClN2S |
| Molecular Weight | 162.6405 |
| Melting point | 172℃ |
| Boiling point | 220.8°C at 760 mmHg |
| Flash point | 87.3°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
54610-70-7 thiophene-2-carboximidamide hydrochloride
service@apichina.com