| Product Name | Thiodiglycolic anhydride |
| CAS No. | 3261-87-8 |
| Synonyms | 1,4-Oxathiane-2,6-dione; 2,2-Thiodiacetic acid anhydride; 1,4-oxathiane-2,6-dione |
| InChI | InChI=1/C4H4O3S/c5-3-1-8-2-4(6)7-3/h1-2H2 |
| Molecular Formula | C4H4O3S |
| Molecular Weight | 132.1378 |
| Density | 1.468g/cm3 |
| Melting point | 93-94℃ |
| Boiling point | 341.8°C at 760 mmHg |
| Flash point | 190.5°C |
| Refractive index | 1.545 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3261-87-8 thiodiglycolic anhydride
service@apichina.com