| Product Name | thiodi(succinic acid) |
| CAS No. | 4917-76-4 |
| Synonyms | Thiodisuccinicacid; Thiodisuccinic acid; 2,2'-sulfanediyldibutanedioic acid |
| InChI | InChI=1/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
| Molecular Formula | C7H5FN2 |
| Molecular Weight | 136.1264 |
| Density | 1.371g/cm3 |
| Refractive index | 1.659 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4917-76-4 thiodi(succinic acid)
service@apichina.com