| Product Name | thieno[3,2-b]thiophene-2-carboxylic acid |
| CAS No. | 1723-27-9 |
| InChI | InChI=1/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9) |
| Molecular Formula | C7H4O2S2 |
| Molecular Weight | 184.2355 |
| Density | 1.601g/cm3 |
| Melting point | 218℃ |
| Boiling point | 386.7°C at 760 mmHg |
| Flash point | 187.6°C |
| Refractive index | 1.769 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
service@apichina.com