| Product Name | Thianthrene-1-boronic acid |
| CAS No. | 108847-76-3 |
| Synonyms | 1-Thianthrenylboronic acid; thianthren-1-ylboronic acid |
| InChI | InChI=1/C12H9BO2S2/c14-13(15)8-4-3-7-11-12(8)17-10-6-2-1-5-9(10)16-11/h1-7,14-15H |
| Molecular Formula | C12H9BO2S2 |
| Molecular Weight | 260.1397 |
| Density | 1.48g/cm3 |
| Melting point | 146-149℃ |
| Boiling point | 472.7°C at 760 mmHg |
| Flash point | 239.7°C |
| Refractive index | 1.756 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
108847-76-3 thianthrene-1-boronic acid
service@apichina.com