Product Name | Tetraphenylphthalic anhydride |
CAS No. | 4741-53-1 |
Synonyms | 4,5,6,7-tetraphenyl-2-benzofuran-1,3-dione |
InChI | InChI=1/C32H20O3/c33-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30(29)32(34)35-31)24-19-11-4-12-20-24/h1-20H |
Molecular Formula | C32H20O3 |
Molecular Weight | 452.4994 |
Density | 1.244g/cm3 |
Boiling point | 596°C at 760 mmHg |
Flash point | 290.4°C |
Refractive index | 1.658 |
Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4741-53-1 tetraphenylphthalic anhydride
service@apichina.com