| Product Name | tetramethylammonium triacetoxy borohydride |
| CAS No. | 109704-53-2 |
| InChI | InChI=1/C6H10BO6.C4H12N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-5(2,3)4/h7H,1-3H3;1-4H3/q-1;+1 |
| Molecular Formula | C10H22BNO6 |
| Molecular Weight | 263.0958 |
| Melting point | 93-98℃ |
| Risk Codes | R15:Contact with water liberates highly flammable gases.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
109704-53-2 tetramethylammonium triacetoxy borohydride
service@apichina.com