| Product Name | Tetrahydrofurfuryl methacrylate |
| CAS No. | 2455-24-5 |
| Synonyms | Methacrylic acid tetrahydrofurfuryl ester; tetrahydrofuran-2-ylmethyl 2-methylprop-2-enoate |
| InChI | InChI=1/C9H14O3/c1-7(2)9(10)12-6-8-4-3-5-11-8/h8H,1,3-6H2,2H3 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.2057 |
| Density | 1.03g/cm3 |
| Boiling point | 265°C at 760 mmHg |
| Flash point | 105.6°C |
| Refractive index | 1.452 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S36:; |
2455-24-5 tetrahydrofurfuryl methacrylate
service@apichina.com