| Product Name | Tetrahydrofuran-2,3,4,5-tetracarboxylic acid |
| CAS No. | 26106-63-8 |
| Synonyms | Tetrahydrofuran-2r,3t,4t,5c-tetracarboxylic acid; 2,5-anhydro-3,4-dicarboxy-3,4-dideoxyhexaric acid; (2R,3S,4S,5S)-tetrahydrofuran-2,3,4,5-tetracarboxylate (non-preferred name); (2R,3R,4S,5S)-tetrahydrofuran-2,3,4,5-tetracarboxylate (non-preferred name); 2,5-anhydro-3,4-dicarboxy-3,4-dideoxy-D-allaric acid |
| InChI | InChI=1/C8H8O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/t1-,2+,3-,4+ |
| Molecular Formula | C8H8O9 |
| Molecular Weight | 248.1437 |
| Density | 1.927g/cm3 |
| Melting point | 207℃ |
| Boiling point | 597.011°C at 760 mmHg |
| Flash point | 243.903°C |
| Refractive index | 1.607 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
26106-63-8 tetrahydrofuran-2,3,4,5-tetracarboxylic acid
service@apichina.com