| Product Name | Tetrachloropyrocatechol |
| CAS No. | 1198-55-6 |
| Synonyms | Tetrachlorocatechol; 3,4,5,6-tetrachlorobenzene-1,2-diol |
| InChI | InChI=1/C6H2Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| Molecular Formula | C6H2Cl4O2 |
| Molecular Weight | 247.8909 |
| Density | 1.848g/cm3 |
| Boiling point | 309.1°C at 760 mmHg |
| Flash point | 140.7°C |
| Refractive index | 1.661 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R41:Risks of serious damage to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1198-55-6 tetrachloropyrocatechol
service@apichina.com