| Product Name | Tetrabromocatechol |
| CAS No. | 488-47-1 |
| Synonyms | Tetrabromopyrocatechol; Tetrabromocatechol, (Tetrabromopyrocatechol); 3,4,5,6-tetrabromobenzene-1,2-diol |
| InChI | InChI=1/C6H2Br4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| Molecular Formula | C6H2Br4O2 |
| Molecular Weight | 425.6949 |
| Density | 2.818g/cm3 |
| Melting point | 189-193℃ |
| Boiling point | 339.3°C at 760 mmHg |
| Flash point | 159°C |
| Refractive index | 1.737 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
488-47-1 tetrabromocatechol
service@apichina.com
- Next:488-48-2 tetrabromo-p-benzoquinone
- Previous:488-45-9 l-iditol