| Product Name | Tetrabromo-o-benzoquinone |
| CAS No. | 2435-54-3 |
| Synonyms | o-Bromanil; 3,4,5,6-tetrabromocyclohexa-3,5-diene-1,2-dione |
| InChI | InChI=1/C6Br4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| Molecular Formula | C6Br4O2 |
| Molecular Weight | 423.679 |
| Density | 3.127g/cm3 |
| Melting point | 145-150℃ |
| Boiling point | 197.9°C at 760 mmHg |
| Flash point | 37.7°C |
| Refractive index | 1.806 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S37:Wear suitable gloves.; |
2435-54-3 tetrabromo-o-benzoquinone
service@apichina.com