| Product Name | Terephthalic dihydrazide |
| CAS No. | 136-64-1 |
| Synonyms | Benzene-1,4-dicarboxylic acid dihydrazide; benzene-1,4-dicarbohydrazide |
| InChI | InChI=1/C8H10N4O2/c9-11-7(13)5-1-2-6(4-3-5)8(14)12-10/h1-4H,9-10H2,(H,11,13)(H,12,14) |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.1906 |
| Density | 1.344g/cm3 |
| Refractive index | 1.628 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
136-64-1 terephthalic dihydrazide
service@apichina.com