| Product Name | Terephthalic acid mono(2-bromoethyl) ester |
| CAS No. | 173550-97-5 |
| Synonyms | 2-Bromoethyl hydrogen terephthalate; 4-[(2-bromoethoxy)carbonyl]benzoic acid |
| InChI | InChI=1/C10H9BrO4/c11-5-6-15-10(14)8-3-1-7(2-4-8)9(12)13/h1-4H,5-6H2,(H,12,13) |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.0801 |
| Density | 1.61g/cm3 |
| Boiling point | 412.8°C at 760 mmHg |
| Flash point | 203.5°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
173550-97-5 terephthalic acid mono(2-bromoethyl) ester
service@apichina.com