| Sales Email | Service@apichina.com |
| CAS No. | 306-37-6 |
| Product Name | sym-Dimethylhydrazine dihydrochloride |
| Synonyms | 1,2-Dimethylhydrazine dihydrochloride; 1,2-dimethylhydrazine; 1,1-dimethylhydrazine dihydrochloride |
| InChI | InChI=1/C2H8N2.2ClH/c1-4(2)3;;/h3H2,1-2H3;2*1H |
| Molecular Formula | C2H10Cl2N2 |
| Molecular Weight | 133.0202 |
| Melting point | 166-167℃ |
| Boiling point | 63.9°C at 760 mmHg |
| Flash point | 1.1°C |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R45:May cause cancer.; |
| Safety | S24/25:Avoid contact with skin and eyes.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
