| Product Name | sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1) |
| CAS No. | 77902-86-4 |
| Synonyms | Sulfuric acid, compd. with 2H-1-benzopyran-2-one (1:1); 1-Benzopyrylium, 2-hydroxy-, bisulfate salt; Sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1); 2H-chromen-2-one - sulfuric acid (1:1) |
| InChI | InChI=1/C9H6O2.H2O4S/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-5(2,3)4/h1-6H;(H2,1,2,3,4) |
| Molecular Formula | C9H8O6S |
| Molecular Weight | 244.2212 |
| Boiling point | 298°C at 760 mmHg |
| Flash point | 118.3°C |
77902-86-4 sulphuric acid, compound with 2h-1-benzopyran-2-one (1:1)
service@apichina.com