| Product Name | Sulfuric acid, mono-C8-30-alkyl esters, compds. with triethanolamine |
| CAS No. | 68412-83-9 |
| Synonyms | Mixed (C8-C30) alcohols, sulfated, triethanolamine salt; Sulfuric acid, mono-C8-3O-alkyl esters, compds. with triethanolamine; 2-(bis(2-hydroxyethyl)amino)ethanol sulfate |
| InChI | InChI=1/C6H15NO3.H2O4S/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;(H2,1,2,3,4)/p-2 |
| Molecular Formula | C6H15NO7S |
| Molecular Weight | 245.2519 |
| Boiling point | 335.4°C at 760 mmHg |
| Flash point | 185°C |
68412-83-9 sulfuric acid, mono-c8-30-alkyl esters, compds. with triethanolamine
service@apichina.com