| Product Name | Sudan II |
| CAS No. | 3118-97-6 |
| Synonyms | C.I. 12140; C.I. Solvent Orange 7; C.I. Solvent Orange 7 (8CI); 1-(2,4-Dimethylphenylazo)-2-naphthol; Solvent Orange 7; sudan ii (C.I. 12140); 1-(2,4-XYLIDYLAZO)-2-NAPHTHOL; 1-[2,4-XYLYLAZO]-2-NAPHTHOL; FAT PONCEAU; CI 12140; CI NO 12140; CALCO OIL SCARLET BL; CALCO OIL SCARLET ZBL; 1-[(2,4-dimethylphenyl)hydrazono]naphthalen-2(1H)-one; (1E)-1-[(2,4-dimethylphenyl)hydrazono]naphthalen-2(1H)-one; Solvent Orange 7 |
| InChI | InChI=1/C18H16N2O/c1-12-7-9-16(13(2)11-12)19-20-18-15-6-4-3-5-14(15)8-10-17(18)21/h3-11,19H,1-2H3/b20-18+ |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.3324 |
| Density | 1.14g/cm3 |
| Melting point | 156-158℃ |
| Boiling point | 429.6°C at 760 mmHg |
| Flash point | 213.6°C |
| Refractive index | 1.615 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3118-97-6 sudan ii
service@apichina.com