| Product Name | Succinyl chloride |
| CAS No. | 543-20-4 |
| Synonyms | Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
| InChI | InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
| Molecular Formula | C4H4Cl2O2 |
| Molecular Weight | 154.9794 |
| Density | 1.389g/cm3 |
| Melting point | 16-17℃ |
| Boiling point | 193.4°C at 760 mmHg |
| Flash point | 76.7°C |
| Refractive index | 1.456 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
543-20-4 succinyl chloride
service@apichina.com