| Product Name | Suberic dihydrazide |
| CAS No. | 20247-84-1 |
| Synonyms | octanedihydrazide |
| InChI | InChI=1/C8H18N4O2/c9-11-7(13)5-3-1-2-4-6-8(14)12-10/h1-6,9-10H2,(H,11,13)(H,12,14) |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.2541 |
| Density | 1.124g/cm3 |
| Boiling point | 510.9°C at 760 mmHg |
| Flash point | 262.8°C |
| Refractive index | 1.506 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20247-84-1 suberic dihydrazide
service@apichina.com