| Product Name | stearic acid, monoester with butanediol |
| CAS No. | 1335-20-2 |
| Synonyms | Octadecanoic acid, monoester with butanediol; Stearic acid, monoester with butanediol; 4-hydroxybutyl octadecanoate |
| InChI | InChI=1/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(24)25-21-18-17-20-23/h23H,2-21H2,1H3 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.583 |
| Density | 0.908g/cm3 |
| Boiling point | 454.2°C at 760 mmHg |
| Flash point | 167.4°C |
| Refractive index | 1.458 |
1335-20-2 stearic acid, monoester with butanediol
service@apichina.com