| Product Name | stearic acid, compound with N,N-dimethyloctadecylamine (1:1) |
| CAS No. | 14745-75-6 |
| Synonyms | Octadecanoic acid, compd. with N,N-dimethyl-1-octadecanamine (1:1); Dimethyloctadecylamine stearate; Stearic acid, compound with N,N-dimethyloctadecylamine (1:1); Stearic acid, compd. with N,N-dimethyloctadecylamine (1:1); octadecanoic acid - N,N-dimethyloctadecan-1-amine (1:1) |
| InChI | InChI=1/C20H43N.C18H36O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h4-20H2,1-3H3;2-17H2,1H3,(H,19,20) |
| Molecular Formula | C38H79NO2 |
| Molecular Weight | 582.0394 |
| Boiling point | 348.5°C at 760 mmHg |
| Flash point | 153.8°C |
14745-75-6 stearic acid, compound with n,n-dimethyloctadecylamine (1:1)
service@apichina.com