| Product Name | stearic acid, compound with N,N-dimethyldodecylamine (1:1) |
| CAS No. | 70715-12-7 |
| Synonyms | Octadecanoic acid, compd. with N,N-dimethyl-1-dodecanamine (1:1); Lauryldimethylamine stearate; Stearic acid lauryldimethylamine salt; Stearic acid, compound with N,N-dimethyldodecylamine (1:1); octadecanoic acid - N,N-dimethyldodecan-1-amine (1:1) |
| InChI | InChI=1/C18H36O2.C14H31N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h2-17H2,1H3,(H,19,20);4-14H2,1-3H3 |
| Molecular Formula | C32H67NO2 |
| Molecular Weight | 497.8799 |
| Boiling point | 359.4°C at 760 mmHg |
| Flash point | 162.4°C |
70715-12-7 stearic acid, compound with n,n-dimethyldodecylamine (1:1)
service@apichina.com