| Product Name | stearic acid, compound with 1-dodecylpiperidine (1:1) |
| CAS No. | 68141-04-8 |
| Synonyms | Octadecanoic acid, compd. with 1-dodecylpiperidine (1:1); Dodecylpiperidine octadecanoate; N-Dodecylpiperidinium stearate; Stearic acid, compound with 1-dodecylpiperidine (1:1); octadecanoic acid - 1-dodecylpiperidine (1:1) |
| InChI | InChI=1/C18H36O2.C17H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-12-15-18-16-13-11-14-17-18/h2-17H2,1H3,(H,19,20);2-17H2,1H3 |
| Molecular Formula | C35H71NO2 |
| Molecular Weight | 537.9437 |
| Boiling point | 359.4°C at 760 mmHg |
| Flash point | 162.4°C |
68141-04-8 stearic acid, compound with 1-dodecylpiperidine (1:1)
service@apichina.com