| Product Name | Sodium bromoacetate |
| CAS No. | 1068-52-6 |
| Synonyms | Bromoacetic acid sodium salt |
| InChI | InChI=1/C2H3BrO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| Molecular Formula | C2H2BrNaO2 |
| Molecular Weight | 160.9298 |
| Boiling point | 207°C at 760 mmHg |
| Flash point | 79°C |
| Risk Codes | R25:Toxic if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1068-52-6 sodium bromoacetate
service@apichina.com