| Product Name | sec-butyl isobutyl hydrogen phosphate, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:1) |
| CAS No. | 98510-84-0 |
| Synonyms | sec-Butyl isobutyl hydrogen phosphate, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:1); 2-ethyl-N-(2-ethylhexyl)hexan-1-amine; isobutyl sec-butyl hydrogen phosphate |
| InChI | InChI=1/C16H35N.C8H19O4P/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;1-5-8(4)12-13(9,10)11-6-7(2)3/h15-17H,5-14H2,1-4H3;7-8H,5-6H2,1-4H3,(H,9,10) |
| Molecular Formula | C24H54NO4P |
| Molecular Weight | 451.6636 |
| Boiling point | 508.1°C at 760 mmHg |
| Flash point | 261.1°C |
98510-84-0 sec-butyl isobutyl hydrogen phosphate, compound with 2-ethyl-n-(2-ethylhexyl)hexylamine (
service@apichina.com