| Product Name | S-n-Butyl thioacetate |
| CAS No. | 928-47-2 |
| Synonyms | Thioacetic acid S-n-butyl ester; S-butyl ethanethioate; S-butan-2-yl ethanethioate |
| InChI | InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.2239 |
| Density | 0.95g/cm3 |
| Boiling point | 158.1°C at 760 mmHg |
| Flash point | 44°C |
| Refractive index | 1.456 |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
928-47-2 s-n-butyl thioacetate
service@apichina.com