| Product Name | (S)-(-)-N-Acetyl-1-methylbenzylamine |
| CAS No. | 19144-86-6 |
| Synonyms | (3beta)-3-hydroxycholest-5-en-22-one; N-[(1S)-1-phenylethyl]acetamide |
| InChI | InChI=1/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m0/s1 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.2163 |
| Density | 1.007g/cm3 |
| Melting point | 102℃ |
| Boiling point | 327.9°C at 760 mmHg |
| Flash point | 192.2°C |
| Refractive index | 1.513 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
19144-86-6 (s)-(-)-n-acetyl-1-methylbenzylamine
service@apichina.com