| Product Name | (S)-N-(2-Propyl)-1-phenylethylamine hydrochloride |
| CAS No. | 116297-12-2 |
| Synonyms | (S)-N-Isopropyl-1-phenylethylamine hydrochloride; N-[(1S)-1-phenylethyl]propan-2-amine hydrochloride |
| InChI | InChI=1/C11H17N.ClH/c1-9(2)12-10(3)11-7-5-4-6-8-11;/h4-10,12H,1-3H3;1H/t10-;/m0./s1 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.7203 |
| Boiling point | 254.6°C at 760 mmHg |
| Flash point | 107.8°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
116297-12-2 (s)-n-(2-propyl)-1-phenylethylamine hydrochloride
service@apichina.com